C27H38N4O2 — CID 71017736
1-(3-methylphenyl)-3-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]cyclohexyl]urea (PubChem CID 71017736) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]cyclohexyl]urea.
| Compound Name | 1-(3-methylphenyl)-3-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]cyclohexyl]urea |
|---|---|
| PubChem CID | 71017736 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 1-(3-methylphenyl)-3-[4-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]cyclohexyl]urea |
| SMILES | Cc1cccc(NC(=O)NC2CCC(N3CCN(c4ccccc4OC(C)C)CC3)CC2)c1 |
| InChI | InChI=1S/C27H38N4O2/c1-20(2)33-26-10-5-4-9-25(26)31-17-15-30(16-18-31)24-13-11-22(12-14-24)28-27(32)29-23-8-6-7-21(3)19-23/h4-10,19-20,22,24H,11-18H2,1-3H3,(H2,28,29,32) |
| InChIKey | VKIIDFQEDDJAJI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |