C25H32F2N4O2 — CID 143389111
1-(2,4-difluorophenyl)-3-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]cyclohexyl]urea (PubChem CID 143389111) has the molecular formula C25H32F2N4O2 and a molecular weight of 458.55 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]cyclohexyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]cyclohexyl]urea |
|---|---|
| PubChem CID | 143389111 |
| Molecular Formula | C25H32F2N4O2 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[4-[4-(2-ethoxyphenyl)piperazin-1-yl]cyclohexyl]urea |
| SMILES | CCOc1ccccc1N1CCN(C2CCC(NC(=O)Nc3ccc(F)cc3F)CC2)CC1 |
| InChI | InChI=1S/C25H32F2N4O2/c1-2-33-24-6-4-3-5-23(24)31-15-13-30(14-16-31)20-10-8-19(9-11-20)28-25(32)29-22-12-7-18(26)17-21(22)27/h3-7,12,17,19-20H,2,8-11,13-16H2,1H3,(H2,28,29,32) |
| InChIKey | LUFXIUNWKSSMOL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |