C23H23FN4O4 — CID 71020305
3-[2-[2-benzamidoethyl(ethyl)amino]-2-oxoacetyl]-4-fluoro-N-methyl-1H-indole-7-carboxamide (PubChem CID 71020305) has the molecular formula C23H23FN4O4 and a molecular weight of 438.46 g/mol. Its IUPAC name is 3-[2-[2-benzamidoethyl(ethyl)amino]-2-oxoacetyl]-4-fluoro-N-methyl-1H-indole-7-carboxamide.
| Compound Name | 3-[2-[2-benzamidoethyl(ethyl)amino]-2-oxoacetyl]-4-fluoro-N-methyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 71020305 |
| Molecular Formula | C23H23FN4O4 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-[2-[2-benzamidoethyl(ethyl)amino]-2-oxoacetyl]-4-fluoro-N-methyl-1H-indole-7-carboxamide |
| SMILES | CCN(CCNC(=O)c1ccccc1)C(=O)C(=O)c1c[nH]c2c(C(=O)NC)ccc(F)c12 |
| InChI | InChI=1S/C23H23FN4O4/c1-3-28(12-11-26-21(30)14-7-5-4-6-8-14)23(32)20(29)16-13-27-19-15(22(31)25-2)9-10-17(24)18(16)19/h4-10,13,27H,3,11-12H2,1-2H3,(H,25,31)(H,26,30) |
| InChIKey | ZGRRRKWUPAHDOH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|