C28H28Cl2FN3O4 — CID 71023081
CID 71023081 (PubChem CID 71023081) has the molecular formula C28H28Cl2FN3O4 and a molecular weight of 560.45 g/mol.
| Compound Name | CID 71023081 |
|---|---|
| PubChem CID | 71023081 |
| Molecular Formula | C28H28Cl2FN3O4 |
| Molecular Weight | 560.45 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | — |
| SMILES | O=C(O)C1CC(NC(=O)[C@@H]2NC3(CCCCC3)[C@@]3(C(=O)Nc4cc(Cl)ccc43)[C@H]2c2cccc(Cl)c2F)C1 |
| InChI | InChI=1S/C28H28Cl2FN3O4/c29-15-7-8-18-20(13-15)33-26(38)28(18)21(17-5-4-6-19(30)22(17)31)23(34-27(28)9-2-1-3-10-27)24(35)32-16-11-14(12-16)25(36)37/h4-8,13-14,16,21,23,34H,1-3,9-12H2,(H,32,35)(H,33,38)(H,36,37)/t14?,16?,21-,23+,28+/m0/s1 |
| InChIKey | DZYYWNZGJJMGEO-VJFLUZFSSA-N |
| XLogP | 4.76 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |