C24H23N3O5 — CID 71024555
3-oxo-4-[(2S)-1-[(2S)-1-phenylmethoxycarbonyl-2,5-dihydropyrrol-2-yl]propan-2-yl]quinoxaline-2-carboxylic acid (PubChem CID 71024555) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is 3-oxo-4-[(2S)-1-[(2S)-1-phenylmethoxycarbonyl-2,5-dihydropyrrol-2-yl]propan-2-yl]quinoxaline-2-carboxylic acid.
| Compound Name | 3-oxo-4-[(2S)-1-[(2S)-1-phenylmethoxycarbonyl-2,5-dihydropyrrol-2-yl]propan-2-yl]quinoxaline-2-carboxylic acid |
|---|---|
| PubChem CID | 71024555 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 3-oxo-4-[(2S)-1-[(2S)-1-phenylmethoxycarbonyl-2,5-dihydropyrrol-2-yl]propan-2-yl]quinoxaline-2-carboxylic acid |
| SMILES | C[C@@H](C[C@H]1C=CCN1C(=O)OCc1ccccc1)n1c(=O)c(C(=O)O)nc2ccccc21 |
| InChI | InChI=1S/C24H23N3O5/c1-16(27-20-12-6-5-11-19(20)25-21(22(27)28)23(29)30)14-18-10-7-13-26(18)24(31)32-15-17-8-3-2-4-9-17/h2-12,16,18H,13-15H2,1H3,(H,29,30)/t16-,18+/m0/s1 |
| InChIKey | RQYZIAPTVAZUEB-FUHWJXTLSA-N |
| XLogP | 3.62 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|