C18H23IN4O — CID 71028605
1-(4-tert-butylphenyl)-3-[2-[(3-iodo-2-pyridinyl)amino]ethyl]urea (PubChem CID 71028605) has the molecular formula C18H23IN4O and a molecular weight of 438.31 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[2-[(3-iodo-2-pyridinyl)amino]ethyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[2-[(3-iodo-2-pyridinyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 71028605 |
| Molecular Formula | C18H23IN4O |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[2-[(3-iodo-2-pyridinyl)amino]ethyl]urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)NCCNc2ncccc2I)cc1 |
| InChI | InChI=1S/C18H23IN4O/c1-18(2,3)13-6-8-14(9-7-13)23-17(24)22-12-11-21-16-15(19)5-4-10-20-16/h4-10H,11-12H2,1-3H3,(H,20,21)(H2,22,23,24) |
| InChIKey | JEOQIKKYUJSFOC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|