C13H8BrCl2NO — CID 710302
2-[(4-bromophenyl)iminomethyl]-4,6-dichlorophenol (PubChem CID 710302) has the molecular formula C13H8BrCl2NO and a molecular weight of 345.02 g/mol. Its IUPAC name is 2-[(4-bromophenyl)iminomethyl]-4,6-dichlorophenol.
| Compound Name | 2-[(4-bromophenyl)iminomethyl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 710302 |
| Molecular Formula | C13H8BrCl2NO |
| Molecular Weight | 345.02 g/mol |
| Exact Mass | 342.92 |
| IUPAC Name | 2-[(4-bromophenyl)iminomethyl]-4,6-dichlorophenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1/C=N/c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H8BrCl2NO/c14-9-1-3-11(4-2-9)17-7-8-5-10(15)6-12(16)13(8)18/h1-7,18H/b17-7+ |
| InChIKey | SCFYGKJRFQUEST-REZTVBANSA-N |
| XLogP | 5.21 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.02 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|