C16H19IN6O — CID 71030668
3-[[4-[(4-iodophenyl)methylamino]-1-methylpyrazolo[3,4-d]pyrimidin-6-yl]amino]propan-1-ol (PubChem CID 71030668) has the molecular formula C16H19IN6O and a molecular weight of 438.27 g/mol. Its IUPAC name is 3-[[4-[(4-iodophenyl)methylamino]-1-methylpyrazolo[3,4-d]pyrimidin-6-yl]amino]propan-1-ol.
| Compound Name | 3-[[4-[(4-iodophenyl)methylamino]-1-methylpyrazolo[3,4-d]pyrimidin-6-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 71030668 |
| Molecular Formula | C16H19IN6O |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 3-[[4-[(4-iodophenyl)methylamino]-1-methylpyrazolo[3,4-d]pyrimidin-6-yl]amino]propan-1-ol |
| SMILES | Cn1ncc2c(NCc3ccc(I)cc3)nc(NCCCO)nc21 |
| InChI | InChI=1S/C16H19IN6O/c1-23-15-13(10-20-23)14(21-16(22-15)18-7-2-8-24)19-9-11-3-5-12(17)6-4-11/h3-6,10,24H,2,7-9H2,1H3,(H2,18,19,21,22) |
| InChIKey | FUJVEQUKJPEMNT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|