C19H26N6O3 — CID 50795281
4-N-[(2,5-dimethoxyphenyl)methyl]-6-N-(3-methoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine (PubChem CID 50795281) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-N-[(2,5-dimethoxyphenyl)methyl]-6-N-(3-methoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[(2,5-dimethoxyphenyl)methyl]-6-N-(3-methoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 50795281 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 4-N-[(2,5-dimethoxyphenyl)methyl]-6-N-(3-methoxypropyl)-1-methylpyrazolo[3,4-d]pyrimidine-4,6-diamine |
| SMILES | COCCCNc1nc(NCc2cc(OC)ccc2OC)c2cnn(C)c2n1 |
| InChI | InChI=1S/C19H26N6O3/c1-25-18-15(12-22-25)17(23-19(24-18)20-8-5-9-26-2)21-11-13-10-14(27-3)6-7-16(13)28-4/h6-7,10,12H,5,8-9,11H2,1-4H3,(H2,20,21,23,24) |
| InChIKey | KVLUAFZZUHWBTH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 95.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|