C12H18N2O2S — CID 71032108
2-(aminomethyl)-3-hydroxy-1-pyrrolidin-1-yl-3-thiophen-3-ylpropan-1-one (PubChem CID 71032108) has the molecular formula C12H18N2O2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 2-(aminomethyl)-3-hydroxy-1-pyrrolidin-1-yl-3-thiophen-3-ylpropan-1-one.
| Compound Name | 2-(aminomethyl)-3-hydroxy-1-pyrrolidin-1-yl-3-thiophen-3-ylpropan-1-one |
|---|---|
| PubChem CID | 71032108 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(aminomethyl)-3-hydroxy-1-pyrrolidin-1-yl-3-thiophen-3-ylpropan-1-one |
| SMILES | NCC(C(=O)N1CCCC1)C(O)c1ccsc1 |
| InChI | InChI=1S/C12H18N2O2S/c13-7-10(11(15)9-3-6-17-8-9)12(16)14-4-1-2-5-14/h3,6,8,10-11,15H,1-2,4-5,7,13H2 |
| InChIKey | LWCMADDVCLDEHI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |