C19H21FN2O2S — CID 71032554
2-[[1-[(3-fluorophenyl)methylsulfonyl]piperidin-4-ylidene]methyl]-6-methylpyridine (PubChem CID 71032554) has the molecular formula C19H21FN2O2S and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-[[1-[(3-fluorophenyl)methylsulfonyl]piperidin-4-ylidene]methyl]-6-methylpyridine.
| Compound Name | 2-[[1-[(3-fluorophenyl)methylsulfonyl]piperidin-4-ylidene]methyl]-6-methylpyridine |
|---|---|
| PubChem CID | 71032554 |
| Molecular Formula | C19H21FN2O2S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[[1-[(3-fluorophenyl)methylsulfonyl]piperidin-4-ylidene]methyl]-6-methylpyridine |
| SMILES | Cc1cccc(C=C2CCN(S(=O)(=O)Cc3cccc(F)c3)CC2)n1 |
| InChI | InChI=1S/C19H21FN2O2S/c1-15-4-2-7-19(21-15)13-16-8-10-22(11-9-16)25(23,24)14-17-5-3-6-18(20)12-17/h2-7,12-13H,8-11,14H2,1H3 |
| InChIKey | MRXIYZQOEPPNQP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |