C16H25N3O2S — CID 71032747
(2R)-1-[2-(ethylamino)ethyl-methylamino]-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propan-2-ol (PubChem CID 71032747) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is (2R)-1-[2-(ethylamino)ethyl-methylamino]-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propan-2-ol.
| Compound Name | (2R)-1-[2-(ethylamino)ethyl-methylamino]-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propan-2-ol |
|---|---|
| PubChem CID | 71032747 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | (2R)-1-[2-(ethylamino)ethyl-methylamino]-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]propan-2-ol |
| SMILES | CCNCCN(C)C[C@@H](O)COc1ccc2sc(C)nc2c1 |
| InChI | InChI=1S/C16H25N3O2S/c1-4-17-7-8-19(3)10-13(20)11-21-14-5-6-16-15(9-14)18-12(2)22-16/h5-6,9,13,17,20H,4,7-8,10-11H2,1-3H3/t13-/m1/s1 |
| InChIKey | YEAFTXYZROEBBC-CYBMUJFWSA-N |
| XLogP | 1.89 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|