C47H42O12P2 — CID 71033966
2-[4-[[4-[4-bis[4-(2-methoxy-2-oxoethyl)phenoxy]phosphanylphenyl]phenyl]-[4-(2-methoxy-2-oxoethyl)phenoxy]phosphanyl]oxyphenyl]acetic acid (PubChem CID 71033966) has the molecular formula C47H42O12P2 and a molecular weight of 860.79 g/mol. Its IUPAC name is 2-[4-[[4-[4-bis[4-(2-methoxy-2-oxoethyl)phenoxy]phosphanylphenyl]phenyl]-[4-(2-methoxy-2-oxoethyl)phenoxy]phosphanyl]oxyphenyl]acetic acid.
| Compound Name | 2-[4-[[4-[4-bis[4-(2-methoxy-2-oxoethyl)phenoxy]phosphanylphenyl]phenyl]-[4-(2-methoxy-2-oxoethyl)phenoxy]phosphanyl]oxyphenyl]acetic acid |
|---|---|
| PubChem CID | 71033966 |
| Molecular Formula | C47H42O12P2 |
| Molecular Weight | 860.79 g/mol |
| Exact Mass | 860.22 |
| IUPAC Name | 2-[4-[[4-[4-bis[4-(2-methoxy-2-oxoethyl)phenoxy]phosphanylphenyl]phenyl]-[4-(2-methoxy-2-oxoethyl)phenoxy]phosphanyl]oxyphenyl]acetic acid |
| SMILES | COC(=O)Cc1ccc(OP(Oc2ccc(CC(=O)O)cc2)c2ccc(-c3ccc(P(Oc4ccc(CC(=O)OC)cc4)Oc4ccc(CC(=O)OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C47H42O12P2/c1-53-45(50)29-33-6-18-39(19-7-33)57-60(56-38-16-4-32(5-17-38)28-44(48)49)42-24-12-36(13-25-42)37-14-26-43(27-15-37)61(58-40-20-8-34(9-21-40)30-46(51)54-2)59-41-22-10-35(11-23-41)31-47(52)55-3/h4-27H,28-31H2,1-3H3,(H,48,49) |
| InChIKey | OSJIRDKTKXAQJQ-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.79 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|