C17H16IN3O3 — CID 71034289
N-[2-(4-iodophenyl)ethyl]-3,6-dimethyl-4-oxofuro[2,3-d]pyrimidine-5-carboxamide (PubChem CID 71034289) has the molecular formula C17H16IN3O3 and a molecular weight of 437.24 g/mol. Its IUPAC name is N-[2-(4-iodophenyl)ethyl]-3,6-dimethyl-4-oxofuro[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-[2-(4-iodophenyl)ethyl]-3,6-dimethyl-4-oxofuro[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 71034289 |
| Molecular Formula | C17H16IN3O3 |
| Molecular Weight | 437.24 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | N-[2-(4-iodophenyl)ethyl]-3,6-dimethyl-4-oxofuro[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1oc2ncn(C)c(=O)c2c1C(=O)NCCc1ccc(I)cc1 |
| InChI | InChI=1S/C17H16IN3O3/c1-10-13(14-16(24-10)20-9-21(2)17(14)23)15(22)19-8-7-11-3-5-12(18)6-4-11/h3-6,9H,7-8H2,1-2H3,(H,19,22) |
| InChIKey | ULBLZXOUFUVCEC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|