C23H22BBrN7O2 — CID 71035579
CID 71035579 (PubChem CID 71035579) has the molecular formula C23H22BBrN7O2 and a molecular weight of 519.19 g/mol.
| Compound Name | CID 71035579 |
|---|---|
| PubChem CID | 71035579 |
| Molecular Formula | C23H22BBrN7O2 |
| Molecular Weight | 519.19 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | — |
| SMILES | CO[B]N1CCN(c2ccncc2NC(=O)c2ccnc(-c3cc4cc(Br)ccc4[nH]3)n2)CC1 |
| InChI | InChI=1S/C23H22BBrN7O2/c1-34-24-32-10-8-31(9-11-32)21-5-6-26-14-20(21)30-23(33)18-4-7-27-22(29-18)19-13-15-12-16(25)2-3-17(15)28-19/h2-7,12-14,28H,8-11H2,1H3,(H,30,33) |
| InChIKey | SUSPVVSXWLNSIN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|