About CID 71035579
CID 71035579 (PubChem CID 71035579) has the molecular formula C23H22BBrN7O2
and a molecular weight of 519.19 g/mol.
Molecular Properties
| Compound Name | CID 71035579 |
| PubChem CID | 71035579 |
| Molecular Formula | C23H22BBrN7O2 |
| Molecular Weight | 519.19 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | — |
| SMILES | CO[B]N1CCN(c2ccncc2NC(=O)c2ccnc(-c3cc4cc(Br)ccc4[nH]3)n2)CC1 |
| InChI | InChI=1S/C23H22BBrN7O2/c1-34-24-32-10-8-31(9-11-32)21-5-6-26-14-20(21)30-23(33)18-4-7-27-22(29-18)19-13-15-12-16(25)2-3-17(15)28-19/h2-7,12-14,28H,8-11H2,1H3,(H,30,33) |
| InChIKey | SUSPVVSXWLNSIN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 519.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 71035579 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71035579?
The IUPAC name of CID 71035579 (CID 71035579) is not available.
What is the SMILES notation for CID 71035579?
The canonical SMILES for CID 71035579 is CO[B]N1CCN(c2ccncc2NC(=O)c2ccnc(-c3cc4cc(Br)ccc4[nH]3)n2)CC1.
What is the InChIKey of CID 71035579?
The InChIKey is SUSPVVSXWLNSIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22BBrN7O2/c1-34-24-32-10-8-31(9-11-32)21-5-6-26-14-20(21)30-23(33)18-4-7-27-22(29-18)19-13-15-12-16(25)2-3-17(15)28-19/h2-7,12-14,28H,8-11H2,1H3,(H,30,33).
What are the key properties of CID 71035579?
CID 71035579 has a molecular weight of 519.19 g/mol, XLogP of 3.34, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71035579 is sourced from PubChem (CID 71035579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).