C19H20BN6O2S — CID 71035586
CID 71035586 (PubChem CID 71035586) has the molecular formula C19H20BN6O2S and a molecular weight of 407.29 g/mol.
| Compound Name | CID 71035586 |
|---|---|
| PubChem CID | 71035586 |
| Molecular Formula | C19H20BN6O2S |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | — |
| SMILES | CO[B]N1CCN(c2ccncc2NC(=O)c2ccnc(-c3ccsc3)n2)CC1 |
| InChI | InChI=1S/C19H20BN6O2S/c1-28-20-26-9-7-25(8-10-26)17-3-5-21-12-16(17)24-19(27)15-2-6-22-18(23-15)14-4-11-29-13-14/h2-6,11-13H,7-10H2,1H3,(H,24,27) |
| InChIKey | OGZPPZOTKKGJKM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|