C20H34N2O6 — CID 71037487
1-[(1R,3S,8R,10S)-12-(2,2-dimethylpropanoyl)-1,8-dihydroxy-2,9-dioxa-5,12-diazatricyclo[8.4.0.03,8]tetradecan-5-yl]-2,2-dimethylpropan-1-one (PubChem CID 71037487) has the molecular formula C20H34N2O6 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-[(1R,3S,8R,10S)-12-(2,2-dimethylpropanoyl)-1,8-dihydroxy-2,9-dioxa-5,12-diazatricyclo[8.4.0.03,8]tetradecan-5-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(1R,3S,8R,10S)-12-(2,2-dimethylpropanoyl)-1,8-dihydroxy-2,9-dioxa-5,12-diazatricyclo[8.4.0.03,8]tetradecan-5-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 71037487 |
| Molecular Formula | C20H34N2O6 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 1-[(1R,3S,8R,10S)-12-(2,2-dimethylpropanoyl)-1,8-dihydroxy-2,9-dioxa-5,12-diazatricyclo[8.4.0.03,8]tetradecan-5-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CC[C@@]2(O)O[C@H]3CN(C(=O)C(C)(C)C)CC[C@@]3(O)O[C@H]2C1 |
| InChI | InChI=1S/C20H34N2O6/c1-17(2,3)15(23)21-9-7-19(25)13(11-21)27-20(26)8-10-22(12-14(20)28-19)16(24)18(4,5)6/h13-14,25-26H,7-12H2,1-6H3/t13-,14-,19+,20+/m0/s1 |
| InChIKey | YURPUJNTHZHPQJ-AFHBHXEDSA-N |
| XLogP | 0.70 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |