C28H36F3N5O5 — CID 71041564
1-[1-cyclohexa-1,5-dien-1-yl-3-[(2R)-2-hydroxy-3-methoxypropoxy]-4-methylpyrazol-5-yl]-3-[(3S,4R)-1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]urea (PubChem CID 71041564) has the molecular formula C28H36F3N5O5 and a molecular weight of 579.62 g/mol. Its IUPAC name is 1-[1-cyclohexa-1,5-dien-1-yl-3-[(2R)-2-hydroxy-3-methoxypropoxy]-4-methylpyrazol-5-yl]-3-[(3S,4R)-1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]urea.
| Compound Name | 1-[1-cyclohexa-1,5-dien-1-yl-3-[(2R)-2-hydroxy-3-methoxypropoxy]-4-methylpyrazol-5-yl]-3-[(3S,4R)-1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 71041564 |
| Molecular Formula | C28H36F3N5O5 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | 1-[1-cyclohexa-1,5-dien-1-yl-3-[(2R)-2-hydroxy-3-methoxypropoxy]-4-methylpyrazol-5-yl]-3-[(3S,4R)-1-(2-methoxyethyl)-4-(3,4,5-trifluorophenyl)pyrrolidin-3-yl]urea |
| SMILES | COCCN1C[C@@H](NC(=O)Nc2c(C)c(OC[C@H](O)COC)nn2C2=CCCC=C2)[C@H](c2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C28H36F3N5O5/c1-17-26(36(19-7-5-4-6-8-19)34-27(17)41-16-20(37)15-40-3)33-28(38)32-24-14-35(9-10-39-2)13-21(24)18-11-22(29)25(31)23(30)12-18/h5,7-8,11-12,20-21,24,37H,4,6,9-10,13-16H2,1-3H3,(H2,32,33,38)/t20-,21+,24-/m1/s1 |
| InChIKey | IDEZGQSVRLWLJT-ZFGGDYGUSA-N |
| XLogP | 3.42 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|