C28H46N2O3 — CID 71048576
2-ethylhexyl N-[[3-[[3-(3-propylcyclopentyl)propanoylamino]methyl]phenyl]methyl]carbamate (PubChem CID 71048576) has the molecular formula C28H46N2O3 and a molecular weight of 458.69 g/mol. Its IUPAC name is 2-ethylhexyl N-[[3-[[3-(3-propylcyclopentyl)propanoylamino]methyl]phenyl]methyl]carbamate.
| Compound Name | 2-ethylhexyl N-[[3-[[3-(3-propylcyclopentyl)propanoylamino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 71048576 |
| Molecular Formula | C28H46N2O3 |
| Molecular Weight | 458.69 g/mol |
| Exact Mass | 458.35 |
| IUPAC Name | 2-ethylhexyl N-[[3-[[3-(3-propylcyclopentyl)propanoylamino]methyl]phenyl]methyl]carbamate |
| SMILES | CCCCC(CC)COC(=O)NCc1cccc(CNC(=O)CCC2CCC(CCC)C2)c1 |
| InChI | InChI=1S/C28H46N2O3/c1-4-7-10-22(6-3)21-33-28(32)30-20-26-12-8-11-25(18-26)19-29-27(31)16-15-24-14-13-23(17-24)9-5-2/h8,11-12,18,22-24H,4-7,9-10,13-17,19-21H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | OHSHDXJPVFXZEC-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.69 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |