C23H27N — CID 71051949
N-cyclohexa-2,4-dien-1-yl-N-(4-methylcyclohexa-1,3-dien-1-yl)-3,4,4a,5-tetrahydronaphthalen-1-amine (PubChem CID 71051949) has the molecular formula C23H27N and a molecular weight of 317.48 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-yl-N-(4-methylcyclohexa-1,3-dien-1-yl)-3,4,4a,5-tetrahydronaphthalen-1-amine.
| Compound Name | N-cyclohexa-2,4-dien-1-yl-N-(4-methylcyclohexa-1,3-dien-1-yl)-3,4,4a,5-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 71051949 |
| Molecular Formula | C23H27N |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-yl-N-(4-methylcyclohexa-1,3-dien-1-yl)-3,4,4a,5-tetrahydronaphthalen-1-amine |
| SMILES | CC1=CC=C(N(C2=CCCC3CC=CC=C23)C2C=CC=CC2)CC1 |
| InChI | InChI=1S/C23H27N/c1-18-14-16-21(17-15-18)24(20-10-3-2-4-11-20)23-13-7-9-19-8-5-6-12-22(19)23/h2-6,10,12-14,16,19-20H,7-9,11,15,17H2,1H3 |
| InChIKey | YEFSDWMESVFJLE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |