C18H26ClF2NO3 — CID 71053326
tert-butyl N-[4-(5-chloro-2-fluorophenyl)-3-hydroxybutyl]-N-(2-fluoropropyl)carbamate (PubChem CID 71053326) has the molecular formula C18H26ClF2NO3 and a molecular weight of 377.86 g/mol. Its IUPAC name is tert-butyl N-[4-(5-chloro-2-fluorophenyl)-3-hydroxybutyl]-N-(2-fluoropropyl)carbamate.
| Compound Name | tert-butyl N-[4-(5-chloro-2-fluorophenyl)-3-hydroxybutyl]-N-(2-fluoropropyl)carbamate |
|---|---|
| PubChem CID | 71053326 |
| Molecular Formula | C18H26ClF2NO3 |
| Molecular Weight | 377.86 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | tert-butyl N-[4-(5-chloro-2-fluorophenyl)-3-hydroxybutyl]-N-(2-fluoropropyl)carbamate |
| SMILES | CC(F)CN(CCC(O)Cc1cc(Cl)ccc1F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26ClF2NO3/c1-12(20)11-22(17(24)25-18(2,3)4)8-7-15(23)10-13-9-14(19)5-6-16(13)21/h5-6,9,12,15,23H,7-8,10-11H2,1-4H3 |
| InChIKey | ZHTXGPXPAINQHF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.86 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |