C22H27N3O2 — CID 71054516
3-methyl-N-phenyl-5-(4-pyrrolidin-1-ylbutanoylamino)benzamide (PubChem CID 71054516) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-methyl-N-phenyl-5-(4-pyrrolidin-1-ylbutanoylamino)benzamide.
| Compound Name | 3-methyl-N-phenyl-5-(4-pyrrolidin-1-ylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 71054516 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 3-methyl-N-phenyl-5-(4-pyrrolidin-1-ylbutanoylamino)benzamide |
| SMILES | Cc1cc(NC(=O)CCCN2CCCC2)cc(C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C22H27N3O2/c1-17-14-18(22(27)24-19-8-3-2-4-9-19)16-20(15-17)23-21(26)10-7-13-25-11-5-6-12-25/h2-4,8-9,14-16H,5-7,10-13H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | IQVGYHZIZCOWPV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |