C17H22O — CID 71058630
1-[3-[2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropyl]phenyl]ethanone (PubChem CID 71058630) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-[3-[2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropyl]phenyl]ethanone.
| Compound Name | 1-[3-[2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropyl]phenyl]ethanone |
|---|---|
| PubChem CID | 71058630 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1-[3-[2,2-dimethyl-1-(2-methylprop-1-enyl)cyclopropyl]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(C2(C=C(C)C)CC2(C)C)c1 |
| InChI | InChI=1S/C17H22O/c1-12(2)10-17(11-16(17,4)5)15-8-6-7-14(9-15)13(3)18/h6-10H,11H2,1-5H3 |
| InChIKey | ONUPIYBTAUPCSQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|