C27H21ClN2O3 — CID 7106075
(3R)-1-benzyl-5-chloro-3-hydroxy-3-[2-oxo-2-(3-pyrrol-1-ylphenyl)ethyl]indol-2-one (PubChem CID 7106075) has the molecular formula C27H21ClN2O3 and a molecular weight of 456.93 g/mol. Its IUPAC name is (3R)-1-benzyl-5-chloro-3-hydroxy-3-[2-oxo-2-(3-pyrrol-1-ylphenyl)ethyl]indol-2-one.
| Compound Name | (3R)-1-benzyl-5-chloro-3-hydroxy-3-[2-oxo-2-(3-pyrrol-1-ylphenyl)ethyl]indol-2-one |
|---|---|
| PubChem CID | 7106075 |
| Molecular Formula | C27H21ClN2O3 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (3R)-1-benzyl-5-chloro-3-hydroxy-3-[2-oxo-2-(3-pyrrol-1-ylphenyl)ethyl]indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)N(Cc2ccccc2)c2ccc(Cl)cc21)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C27H21ClN2O3/c28-21-11-12-24-23(16-21)27(33,26(32)30(24)18-19-7-2-1-3-8-19)17-25(31)20-9-6-10-22(15-20)29-13-4-5-14-29/h1-16,33H,17-18H2/t27-/m1/s1 |
| InChIKey | IBLYWXPHRUSBCV-HHHXNRCGSA-N |
| XLogP | 5.14 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |