C27H30N6O4 — CID 71064984
7-N-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide (PubChem CID 71064984) has the molecular formula C27H30N6O4 and a molecular weight of 502.58 g/mol. Its IUPAC name is 7-N-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide.
| Compound Name | 7-N-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide |
|---|---|
| PubChem CID | 71064984 |
| Molecular Formula | C27H30N6O4 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 7-N-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl]-4-N-[(3-oxo-4H-1,4-benzoxazin-6-yl)methyl]-5H-pyrrolo[3,2-d]pyrimidine-4,7-dicarboxamide |
| SMILES | CC1(C)[C@H]2CCC(CNC(=O)c3c[nH]c4c(C(=O)NCc5ccc6c(c5)NC(=O)CO6)ncnc34)[C@@H]1C2 |
| InChI | InChI=1S/C27H30N6O4/c1-27(2)16-5-4-15(18(27)8-16)10-30-25(35)17-11-28-23-22(17)31-13-32-24(23)26(36)29-9-14-3-6-20-19(7-14)33-21(34)12-37-20/h3,6-7,11,13,15-16,18,28H,4-5,8-10,12H2,1-2H3,(H,29,36)(H,30,35)(H,33,34)/t15?,16-,18-/m0/s1 |
| InChIKey | OHUBBZXKCOVFGR-YLGOGADGSA-N |
| XLogP | 3.02 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |