C23H18BrClN2O3 — CID 7106602
(3S)-3-[2-(4-aminophenyl)-2-oxoethyl]-5-bromo-1-[(2-chlorophenyl)methyl]-3-hydroxyindol-2-one (PubChem CID 7106602) has the molecular formula C23H18BrClN2O3 and a molecular weight of 485.77 g/mol. Its IUPAC name is (3S)-3-[2-(4-aminophenyl)-2-oxoethyl]-5-bromo-1-[(2-chlorophenyl)methyl]-3-hydroxyindol-2-one.
| Compound Name | (3S)-3-[2-(4-aminophenyl)-2-oxoethyl]-5-bromo-1-[(2-chlorophenyl)methyl]-3-hydroxyindol-2-one |
|---|---|
| PubChem CID | 7106602 |
| Molecular Formula | C23H18BrClN2O3 |
| Molecular Weight | 485.77 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | (3S)-3-[2-(4-aminophenyl)-2-oxoethyl]-5-bromo-1-[(2-chlorophenyl)methyl]-3-hydroxyindol-2-one |
| SMILES | Nc1ccc(C(=O)C[C@@]2(O)C(=O)N(Cc3ccccc3Cl)c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C23H18BrClN2O3/c24-16-7-10-20-18(11-16)23(30,12-21(28)14-5-8-17(26)9-6-14)22(29)27(20)13-15-3-1-2-4-19(15)25/h1-11,30H,12-13,26H2/t23-/m0/s1 |
| InChIKey | FIIXFKMBBUSGEY-QHCPKHFHSA-N |
| XLogP | 4.69 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.77 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|