C30H46O4 — CID 71066090
(4R)-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10-oxo-1,3,4,4a,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4-carboxylic acid (PubChem CID 71066090) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is (4R)-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10-oxo-1,3,4,4a,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4-carboxylic acid.
| Compound Name | (4R)-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10-oxo-1,3,4,4a,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4-carboxylic acid |
|---|---|
| PubChem CID | 71066090 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (4R)-9-(hydroxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10-oxo-1,3,4,4a,5,6,6a,7,8,8a,11,12,13,14b-tetradecahydropicene-4-carboxylic acid |
| SMILES | CC1(C)CC2C3=CCC4C5(C)CCC(=O)C(C)(CO)C5CCC4(C)C3(C)CCC2[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C30H46O4/c1-26(2)15-19-18(20(16-26)25(33)34)9-13-29(5)21(19)7-8-23-27(3)12-11-24(32)28(4,17-31)22(27)10-14-30(23,29)6/h7,18-20,22-23,31H,8-17H2,1-6H3,(H,33,34)/t18?,19?,20-,22?,23?,27?,28?,29?,30?/m1/s1 |
| InChIKey | FPAGVTMXHAELHM-IEAPRINYSA-N |
| XLogP | 6.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|