C13H21NO3 — CID 7106886
(4R,7S,12R)-4,8,8,12-tetramethyl-3,9-dioxa-1-azatricyclo[5.4.1.04,12]dodecan-2-one (PubChem CID 7106886) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (4R,7S,12R)-4,8,8,12-tetramethyl-3,9-dioxa-1-azatricyclo[5.4.1.04,12]dodecan-2-one.
| Compound Name | (4R,7S,12R)-4,8,8,12-tetramethyl-3,9-dioxa-1-azatricyclo[5.4.1.04,12]dodecan-2-one |
|---|---|
| PubChem CID | 7106886 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (4R,7S,12R)-4,8,8,12-tetramethyl-3,9-dioxa-1-azatricyclo[5.4.1.04,12]dodecan-2-one |
| SMILES | CC1(C)OCCN2C(=O)O[C@]3(C)CC[C@H]1[C@@]23C |
| InChI | InChI=1S/C13H21NO3/c1-11(2)9-5-6-12(3)13(9,4)14(7-8-16-11)10(15)17-12/h9H,5-8H2,1-4H3/t9-,12-,13-/m1/s1 |
| InChIKey | ZWWCSLNKKSSOED-OASPWFOLSA-N |
| XLogP | 2.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |