C23H40N6O2 — CID 71069075
1-(2-azidoethyl)-5-(cyclohexylmethoxy)-N-(3-ethyl-5-methylheptan-2-yl)pyrazole-4-carboxamide (PubChem CID 71069075) has the molecular formula C23H40N6O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 1-(2-azidoethyl)-5-(cyclohexylmethoxy)-N-(3-ethyl-5-methylheptan-2-yl)pyrazole-4-carboxamide.
| Compound Name | 1-(2-azidoethyl)-5-(cyclohexylmethoxy)-N-(3-ethyl-5-methylheptan-2-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71069075 |
| Molecular Formula | C23H40N6O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 1-(2-azidoethyl)-5-(cyclohexylmethoxy)-N-(3-ethyl-5-methylheptan-2-yl)pyrazole-4-carboxamide |
| SMILES | CCC(C)CC(CC)C(C)NC(=O)c1cnn(CCN=[N+]=[N-])c1OCC1CCCCC1 |
| InChI | InChI=1S/C23H40N6O2/c1-5-17(3)14-20(6-2)18(4)27-22(30)21-15-26-29(13-12-25-28-24)23(21)31-16-19-10-8-7-9-11-19/h15,17-20H,5-14,16H2,1-4H3,(H,27,30) |
| InChIKey | AZYBEXGJGWGEHC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|