About [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate
[(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate (PubChem CID 710742) has the molecular formula C13H8BrNO3
and a molecular weight of 306.12 g/mol. Its IUPAC name is [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate.
Molecular Properties
| Compound Name | [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate |
| PubChem CID | 710742 |
| Molecular Formula | C13H8BrNO3 |
| Molecular Weight | 306.12 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate |
| SMILES | O=C1C=CC(=NOC(=O)c2ccc(Br)cc2)C=C1 |
| InChI | InChI=1S/C13H8BrNO3/c14-10-3-1-9(2-4-10)13(17)18-15-11-5-7-12(16)8-6-11/h1-8H |
| InChIKey | VVLFXPAFAAQKAP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.12 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate?
The IUPAC name of [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate (CID 710742) is [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate.
What is the SMILES notation for [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate?
The canonical SMILES for [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate is O=C1C=CC(=NOC(=O)c2ccc(Br)cc2)C=C1.
What is the InChIKey of [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate?
The InChIKey is VVLFXPAFAAQKAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrNO3/c14-10-3-1-9(2-4-10)13(17)18-15-11-5-7-12(16)8-6-11/h1-8H.
What are the key properties of [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate?
[(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate has a molecular weight of 306.12 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzoate is sourced from PubChem (CID 710742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).