C15H14ClN3O4 — CID 71074694
4-(2-chlorophenyl)-3-[(2-oxo-1H-pyrimidine-5-carbonyl)amino]butanoic acid (PubChem CID 71074694) has the molecular formula C15H14ClN3O4 and a molecular weight of 335.75 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-3-[(2-oxo-1H-pyrimidine-5-carbonyl)amino]butanoic acid.
| Compound Name | 4-(2-chlorophenyl)-3-[(2-oxo-1H-pyrimidine-5-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 71074694 |
| Molecular Formula | C15H14ClN3O4 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 4-(2-chlorophenyl)-3-[(2-oxo-1H-pyrimidine-5-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CC(Cc1ccccc1Cl)NC(=O)c1cnc(=O)[nH]c1 |
| InChI | InChI=1S/C15H14ClN3O4/c16-12-4-2-1-3-9(12)5-11(6-13(20)21)19-14(22)10-7-17-15(23)18-8-10/h1-4,7-8,11H,5-6H2,(H,19,22)(H,20,21)(H,17,18,23) |
| InChIKey | YSSNLLAEBALCJK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |