C14H19N2O2+ — CID 7107761
(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(2-hydroxyethyl)azanium (PubChem CID 7107761) has the molecular formula C14H19N2O2+ and a molecular weight of 247.32 g/mol. Its IUPAC name is (6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(2-hydroxyethyl)azanium.
| Compound Name | (6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 7107761 |
| Molecular Formula | C14H19N2O2+ |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl-(2-hydroxyethyl)azanium |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(C[NH2+]CCO)cc2c1 |
| InChI | InChI=1S/C14H18N2O2/c1-9-5-10(2)13-11(6-9)7-12(14(18)16-13)8-15-3-4-17/h5-7,15,17H,3-4,8H2,1-2H3,(H,16,18)/p+1 |
| InChIKey | YKVUAYJCVLWXNS-UHFFFAOYSA-O |
| XLogP | 0.20 |
| TPSA | 69.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|