C29H38N4O3 — CID 71078485
[4-[1-[5-(6-butyl-1H-benzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]oxycyclohexyl] acetate (PubChem CID 71078485) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is [4-[1-[5-(6-butyl-1H-benzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]oxycyclohexyl] acetate.
| Compound Name | [4-[1-[5-(6-butyl-1H-benzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]oxycyclohexyl] acetate |
|---|---|
| PubChem CID | 71078485 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | [4-[1-[5-(6-butyl-1H-benzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]oxycyclohexyl] acetate |
| SMILES | CCCCc1ccc2nc(-c3ccc(N4CCC(OC5CCC(OC(C)=O)CC5)CC4)nc3)[nH]c2c1 |
| InChI | InChI=1S/C29H38N4O3/c1-3-4-5-21-6-12-26-27(18-21)32-29(31-26)22-7-13-28(30-19-22)33-16-14-25(15-17-33)36-24-10-8-23(9-11-24)35-20(2)34/h6-7,12-13,18-19,23-25H,3-5,8-11,14-17H2,1-2H3,(H,31,32) |
| InChIKey | WPHOCEGOHHYZLE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |