C24H26N4O5 — CID 71110159
3-[1-[5-(6-methyl-1H-benzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]oxycyclobutane-1,1-dicarboxylic acid (PubChem CID 71110159) has the molecular formula C24H26N4O5 and a molecular weight of 450.50 g/mol. Its IUPAC name is 3-[1-[5-(6-methyl-1H-benzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]oxycyclobutane-1,1-dicarboxylic acid.
| Compound Name | 3-[1-[5-(6-methyl-1H-benzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]oxycyclobutane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 71110159 |
| Molecular Formula | C24H26N4O5 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 3-[1-[5-(6-methyl-1H-benzimidazol-2-yl)-2-pyridinyl]piperidin-4-yl]oxycyclobutane-1,1-dicarboxylic acid |
| SMILES | Cc1ccc2nc(-c3ccc(N4CCC(OC5CC(C(=O)O)(C(=O)O)C5)CC4)nc3)[nH]c2c1 |
| InChI | InChI=1S/C24H26N4O5/c1-14-2-4-18-19(10-14)27-21(26-18)15-3-5-20(25-13-15)28-8-6-16(7-9-28)33-17-11-24(12-17,22(29)30)23(31)32/h2-5,10,13,16-17H,6-9,11-12H2,1H3,(H,26,27)(H,29,30)(H,31,32) |
| InChIKey | CLRZCBPZYZRYFH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|