About [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite
[2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite (PubChem CID 71080659) has the molecular formula C19H11FINOS
and a molecular weight of 447.27 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite.
Molecular Properties
| Compound Name | [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite |
| PubChem CID | 71080659 |
| Molecular Formula | C19H11FINOS |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 446.96 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite |
| SMILES | Fc1ccc(-c2ccc(OI)c(-c3nc4ccccc4s3)c2)cc1 |
| InChI | InChI=1S/C19H11FINOS/c20-14-8-5-12(6-9-14)13-7-10-17(23-21)15(11-13)19-22-16-3-1-2-4-18(16)24-19/h1-11H |
| InChIKey | DJUPSMAXVJUHGR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite?
The IUPAC name of [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite (CID 71080659) is [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite.
What is the SMILES notation for [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite?
The canonical SMILES for [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite is Fc1ccc(-c2ccc(OI)c(-c3nc4ccccc4s3)c2)cc1.
What is the InChIKey of [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite?
The InChIKey is DJUPSMAXVJUHGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11FINOS/c20-14-8-5-12(6-9-14)13-7-10-17(23-21)15(11-13)19-22-16-3-1-2-4-18(16)24-19/h1-11H.
What are the key properties of [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite?
[2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite has a molecular weight of 447.27 g/mol, XLogP of 6.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenyl] hypoiodite is sourced from PubChem (CID 71080659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).