C16H15N3O4 — CID 71081079
5-[(7aS)-7-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-3,4-dihydro-2H-chromene-8-carbonitrile (PubChem CID 71081079) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 5-[(7aS)-7-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-3,4-dihydro-2H-chromene-8-carbonitrile.
| Compound Name | 5-[(7aS)-7-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-3,4-dihydro-2H-chromene-8-carbonitrile |
|---|---|
| PubChem CID | 71081079 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 5-[(7aS)-7-hydroxy-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-3,4-dihydro-2H-chromene-8-carbonitrile |
| SMILES | N#Cc1ccc(N2C(=O)[C@@H]3C(O)CCN3C2=O)c2c1OCCC2 |
| InChI | InChI=1S/C16H15N3O4/c17-8-9-3-4-11(10-2-1-7-23-14(9)10)19-15(21)13-12(20)5-6-18(13)16(19)22/h3-4,12-13,20H,1-2,5-7H2/t12?,13-/m0/s1 |
| InChIKey | NBIGWXCAXAXJNU-ABLWVSNPSA-N |
| XLogP | 0.79 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|