C33H22ClNO6 — CID 7108134
(1S,3aR,6aR)-5-[4-(4-chlorophenoxy)phenyl]-1-(4-methylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone (PubChem CID 7108134) has the molecular formula C33H22ClNO6 and a molecular weight of 563.99 g/mol. Its IUPAC name is (1S,3aR,6aR)-5-[4-(4-chlorophenoxy)phenyl]-1-(4-methylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone.
| Compound Name | (1S,3aR,6aR)-5-[4-(4-chlorophenoxy)phenyl]-1-(4-methylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
|---|---|
| PubChem CID | 7108134 |
| Molecular Formula | C33H22ClNO6 |
| Molecular Weight | 563.99 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | (1S,3aR,6aR)-5-[4-(4-chlorophenoxy)phenyl]-1-(4-methylphenyl)spiro[3a,6a-dihydro-1H-furo[3,4-c]pyrrole-3,2'-indene]-1',3',4,6-tetrone |
| SMILES | Cc1ccc([C@H]2OC3(C(=O)c4ccccc4C3=O)[C@@H]3C(=O)N(c4ccc(Oc5ccc(Cl)cc5)cc4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C33H22ClNO6/c1-18-6-8-19(9-7-18)28-26-27(33(41-28)29(36)24-4-2-3-5-25(24)30(33)37)32(39)35(31(26)38)21-12-16-23(17-13-21)40-22-14-10-20(34)11-15-22/h2-17,26-28H,1H3/t26-,27+,28-/m1/s1 |
| InChIKey | ZIVSOIYCCBEZCJ-OZNIXHKMSA-N |
| XLogP | 6.14 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.99 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|