C20H28N4O2 — CID 71089720
N-(5-carbamoyl-2-adamantyl)-6-(propylamino)pyridine-2-carboxamide (PubChem CID 71089720) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-(5-carbamoyl-2-adamantyl)-6-(propylamino)pyridine-2-carboxamide.
| Compound Name | N-(5-carbamoyl-2-adamantyl)-6-(propylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71089720 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N-(5-carbamoyl-2-adamantyl)-6-(propylamino)pyridine-2-carboxamide |
| SMILES | CCCNc1cccc(C(=O)NC2C3CC4CC2CC(C(N)=O)(C4)C3)n1 |
| InChI | InChI=1S/C20H28N4O2/c1-2-6-22-16-5-3-4-15(23-16)18(25)24-17-13-7-12-8-14(17)11-20(9-12,10-13)19(21)26/h3-5,12-14,17H,2,6-11H2,1H3,(H2,21,26)(H,22,23)(H,24,25) |
| InChIKey | CTMZFUREZRXDEV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |