C23H26ClN3O2 — CID 71479373
N-[(1R,3S)-5-carbamoyl-2-adamantyl]-5-(2-chlorophenyl)-1-methylpyrrole-2-carboxamide (PubChem CID 71479373) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is N-[(1R,3S)-5-carbamoyl-2-adamantyl]-5-(2-chlorophenyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[(1R,3S)-5-carbamoyl-2-adamantyl]-5-(2-chlorophenyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71479373 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[(1R,3S)-5-carbamoyl-2-adamantyl]-5-(2-chlorophenyl)-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1c(C(=O)NC2[C@@H]3CC4C[C@H]2CC(C(N)=O)(C4)C3)ccc1-c1ccccc1Cl |
| InChI | InChI=1S/C23H26ClN3O2/c1-27-18(16-4-2-3-5-17(16)24)6-7-19(27)21(28)26-20-14-8-13-9-15(20)12-23(10-13,11-14)22(25)29/h2-7,13-15,20H,8-12H2,1H3,(H2,25,29)(H,26,28)/t13?,14-,15+,20?,23? |
| InChIKey | SCPKENWHSRRTOJ-XILLLFQHSA-N |
| XLogP | 3.76 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |