C19H24FN3O2 — CID 118049701
4-[[2-fluoro-5-(methylamino)benzoyl]amino]adamantane-1-carboxamide (PubChem CID 118049701) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is 4-[[2-fluoro-5-(methylamino)benzoyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[2-fluoro-5-(methylamino)benzoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 118049701 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 4-[[2-fluoro-5-(methylamino)benzoyl]amino]adamantane-1-carboxamide |
| SMILES | CNc1ccc(F)c(C(=O)NC2C3CC4CC2CC(C(N)=O)(C4)C3)c1 |
| InChI | InChI=1S/C19H24FN3O2/c1-22-13-2-3-15(20)14(6-13)17(24)23-16-11-4-10-5-12(16)9-19(7-10,8-11)18(21)25/h2-3,6,10-12,16,22H,4-5,7-9H2,1H3,(H2,21,25)(H,23,24) |
| InChIKey | VHXCCAGPDPBPOJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |