C24H24F3N3O4S — CID 118260382
4-[[3-[(2,4,5-trifluorophenyl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide (PubChem CID 118260382) has the molecular formula C24H24F3N3O4S and a molecular weight of 507.53 g/mol. Its IUPAC name is 4-[[3-[(2,4,5-trifluorophenyl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[3-[(2,4,5-trifluorophenyl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 118260382 |
| Molecular Formula | C24H24F3N3O4S |
| Molecular Weight | 507.53 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 4-[[3-[(2,4,5-trifluorophenyl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide |
| SMILES | NC(=O)C12CC3CC(C1)C(NC(=O)c1cccc(NS(=O)(=O)c4cc(F)c(F)cc4F)c1)C(C3)C2 |
| InChI | InChI=1S/C24H24F3N3O4S/c25-17-7-19(27)20(8-18(17)26)35(33,34)30-16-3-1-2-13(6-16)22(31)29-21-14-4-12-5-15(21)11-24(9-12,10-14)23(28)32/h1-3,6-8,12,14-15,21,30H,4-5,9-11H2,(H2,28,32)(H,29,31) |
| InChIKey | ORKDZRZGDMRKMW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|