C25H26F3N3O4S — CID 118260375
4-[[3-[[2-(trifluoromethyl)phenyl]sulfonylamino]benzoyl]amino]adamantane-1-carboxamide (PubChem CID 118260375) has the molecular formula C25H26F3N3O4S and a molecular weight of 521.56 g/mol. Its IUPAC name is 4-[[3-[[2-(trifluoromethyl)phenyl]sulfonylamino]benzoyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[3-[[2-(trifluoromethyl)phenyl]sulfonylamino]benzoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 118260375 |
| Molecular Formula | C25H26F3N3O4S |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 4-[[3-[[2-(trifluoromethyl)phenyl]sulfonylamino]benzoyl]amino]adamantane-1-carboxamide |
| SMILES | NC(=O)C12CC3CC(C1)C(NC(=O)c1cccc(NS(=O)(=O)c4ccccc4C(F)(F)F)c1)C(C3)C2 |
| InChI | InChI=1S/C25H26F3N3O4S/c26-25(27,28)19-6-1-2-7-20(19)36(34,35)31-18-5-3-4-15(10-18)22(32)30-21-16-8-14-9-17(21)13-24(11-14,12-16)23(29)33/h1-7,10,14,16-17,21,31H,8-9,11-13H2,(H2,29,33)(H,30,32) |
| InChIKey | QEUFHIFPOKFCOD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |