C24H26ClN3O4S — CID 118260381
4-[[3-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide (PubChem CID 118260381) has the molecular formula C24H26ClN3O4S and a molecular weight of 488.01 g/mol. Its IUPAC name is 4-[[3-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[3-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 118260381 |
| Molecular Formula | C24H26ClN3O4S |
| Molecular Weight | 488.01 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 4-[[3-[(4-chlorophenyl)sulfonylamino]benzoyl]amino]adamantane-1-carboxamide |
| SMILES | NC(=O)C12CC3CC(C1)C(NC(=O)c1cccc(NS(=O)(=O)c4ccc(Cl)cc4)c1)C(C3)C2 |
| InChI | InChI=1S/C24H26ClN3O4S/c25-18-4-6-20(7-5-18)33(31,32)28-19-3-1-2-15(10-19)22(29)27-21-16-8-14-9-17(21)13-24(11-14,12-16)23(26)30/h1-7,10,14,16-17,21,28H,8-9,11-13H2,(H2,26,30)(H,27,29) |
| InChIKey | PTKOGQRLIYNCFQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.01 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |