C25H28ClN3O4S — CID 118035168
4-[[3-[(3-chlorophenyl)sulfonyl-methylamino]benzoyl]amino]adamantane-1-carboxamide (PubChem CID 118035168) has the molecular formula C25H28ClN3O4S and a molecular weight of 502.04 g/mol. Its IUPAC name is 4-[[3-[(3-chlorophenyl)sulfonyl-methylamino]benzoyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[3-[(3-chlorophenyl)sulfonyl-methylamino]benzoyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 118035168 |
| Molecular Formula | C25H28ClN3O4S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 4-[[3-[(3-chlorophenyl)sulfonyl-methylamino]benzoyl]amino]adamantane-1-carboxamide |
| SMILES | CN(c1cccc(C(=O)NC2C3CC4CC2CC(C(N)=O)(C4)C3)c1)S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H28ClN3O4S/c1-29(34(32,33)21-7-3-5-19(26)11-21)20-6-2-4-16(10-20)23(30)28-22-17-8-15-9-18(22)14-25(12-15,13-17)24(27)31/h2-7,10-11,15,17-18,22H,8-9,12-14H2,1H3,(H2,27,31)(H,28,30) |
| InChIKey | HPVUFXUDCNNSFV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |