C22H28BrN3O4S — CID 71542303
4-[[2-[(3-bromophenyl)sulfonyl-cyclopropylamino]acetyl]amino]adamantane-1-carboxamide (PubChem CID 71542303) has the molecular formula C22H28BrN3O4S and a molecular weight of 510.45 g/mol. Its IUPAC name is 4-[[2-[(3-bromophenyl)sulfonyl-cyclopropylamino]acetyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[2-[(3-bromophenyl)sulfonyl-cyclopropylamino]acetyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 71542303 |
| Molecular Formula | C22H28BrN3O4S |
| Molecular Weight | 510.45 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 4-[[2-[(3-bromophenyl)sulfonyl-cyclopropylamino]acetyl]amino]adamantane-1-carboxamide |
| SMILES | NC(=O)C12CC3CC(C1)C(NC(=O)CN(C1CC1)S(=O)(=O)c1cccc(Br)c1)C(C3)C2 |
| InChI | InChI=1S/C22H28BrN3O4S/c23-16-2-1-3-18(8-16)31(29,30)26(17-4-5-17)12-19(27)25-20-14-6-13-7-15(20)11-22(9-13,10-14)21(24)28/h1-3,8,13-15,17,20H,4-7,9-12H2,(H2,24,28)(H,25,27) |
| InChIKey | POTUPQMYPXDIGT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |