C22H28FN3O4S — CID 71541828
4-[[2-[cyclopropyl-(4-fluorophenyl)sulfonylamino]acetyl]amino]adamantane-1-carboxamide (PubChem CID 71541828) has the molecular formula C22H28FN3O4S and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-[[2-[cyclopropyl-(4-fluorophenyl)sulfonylamino]acetyl]amino]adamantane-1-carboxamide.
| Compound Name | 4-[[2-[cyclopropyl-(4-fluorophenyl)sulfonylamino]acetyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 71541828 |
| Molecular Formula | C22H28FN3O4S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 4-[[2-[cyclopropyl-(4-fluorophenyl)sulfonylamino]acetyl]amino]adamantane-1-carboxamide |
| SMILES | NC(=O)C12CC3CC(C1)C(NC(=O)CN(C1CC1)S(=O)(=O)c1ccc(F)cc1)C(C3)C2 |
| InChI | InChI=1S/C22H28FN3O4S/c23-16-1-5-18(6-2-16)31(29,30)26(17-3-4-17)12-19(27)25-20-14-7-13-8-15(20)11-22(9-13,10-14)21(24)28/h1-2,5-6,13-15,17,20H,3-4,7-12H2,(H2,24,28)(H,25,27) |
| InChIKey | UAHDXHCSQYNRTQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |