C24H24ClFN3O4S- — CID 131635818
N-(5-carbamoyl-2-adamantyl)-3-[(3-chloro-2-fluorophenyl)sulfonylamino]benzenecarboximidate (PubChem CID 131635818) has the molecular formula C24H24ClFN3O4S- and a molecular weight of 504.99 g/mol. Its IUPAC name is N-(5-carbamoyl-2-adamantyl)-3-[(3-chloro-2-fluorophenyl)sulfonylamino]benzenecarboximidate.
| Compound Name | N-(5-carbamoyl-2-adamantyl)-3-[(3-chloro-2-fluorophenyl)sulfonylamino]benzenecarboximidate |
|---|---|
| PubChem CID | 131635818 |
| Molecular Formula | C24H24ClFN3O4S- |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | N-(5-carbamoyl-2-adamantyl)-3-[(3-chloro-2-fluorophenyl)sulfonylamino]benzenecarboximidate |
| SMILES | NC(=O)C12CC3CC(C1)C(/N=C(\[O-])c1cccc(NS(=O)(=O)c4cccc(Cl)c4F)c1)C(C3)C2 |
| InChI | InChI=1S/C24H25ClFN3O4S/c25-18-5-2-6-19(20(18)26)34(32,33)29-17-4-1-3-14(9-17)22(30)28-21-15-7-13-8-16(21)12-24(10-13,11-15)23(27)31/h1-6,9,13,15-16,21,29H,7-8,10-12H2,(H2,27,31)(H,28,30)/p-1 |
| InChIKey | CSHUOYRDGBYECG-UHFFFAOYSA-M |
| XLogP | 3.07 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|