C23H29FN2O2 — CID 11696680
(3S,5R)-4-[[1-(2-fluorophenyl)cyclopentanecarbonyl]amino]adamantane-1-carboxamide (PubChem CID 11696680) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is (3S,5R)-4-[[1-(2-fluorophenyl)cyclopentanecarbonyl]amino]adamantane-1-carboxamide.
| Compound Name | (3S,5R)-4-[[1-(2-fluorophenyl)cyclopentanecarbonyl]amino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 11696680 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (3S,5R)-4-[[1-(2-fluorophenyl)cyclopentanecarbonyl]amino]adamantane-1-carboxamide |
| SMILES | NC(=O)C12CC3C[C@H](C1)C(NC(=O)C1(c4ccccc4F)CCCC1)[C@@H](C3)C2 |
| InChI | InChI=1S/C23H29FN2O2/c24-18-6-2-1-5-17(18)23(7-3-4-8-23)21(28)26-19-15-9-14-10-16(19)13-22(11-14,12-15)20(25)27/h1-2,5-6,14-16,19H,3-4,7-13H2,(H2,25,27)(H,26,28)/t14?,15-,16+,19?,22? |
| InChIKey | LZLBNEKHWJCACU-YMSKBKNJSA-N |
| XLogP | 3.43 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |