C23H30BrN3O4S — CID 71247838
4-[[1-(2-bromo-N-sulfinoanilino)cyclopentanecarbonyl]amino]-1-carbamoyladamantane (PubChem CID 71247838) has the molecular formula C23H30BrN3O4S and a molecular weight of 524.48 g/mol. Its IUPAC name is 4-[[1-(2-bromo-N-sulfinoanilino)cyclopentanecarbonyl]amino]-1-carbamoyladamantane.
| Compound Name | 4-[[1-(2-bromo-N-sulfinoanilino)cyclopentanecarbonyl]amino]-1-carbamoyladamantane |
|---|---|
| PubChem CID | 71247838 |
| Molecular Formula | C23H30BrN3O4S |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 4-[[1-(2-bromo-N-sulfinoanilino)cyclopentanecarbonyl]amino]-1-carbamoyladamantane |
| SMILES | NC(=O)C12CC3CC(C1)C(NC(=O)C1(N(c4ccccc4Br)S(=O)O)CCCC1)C(C3)C2 |
| InChI | InChI=1S/C23H30BrN3O4S/c24-17-5-1-2-6-18(17)27(32(30)31)23(7-3-4-8-23)21(29)26-19-15-9-14-10-16(19)13-22(11-14,12-15)20(25)28/h1-2,5-6,14-16,19H,3-4,7-13H2,(H2,25,28)(H,26,29)(H,30,31) |
| InChIKey | TWAYRYOCHRISIG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|