C24H32N3O4S- — CID 71247841
1-carbamoyl-4-[[1-(2-methyl-N-sulfinatoanilino)cyclopentanecarbonyl]amino]adamantane (PubChem CID 71247841) has the molecular formula C24H32N3O4S- and a molecular weight of 458.60 g/mol. Its IUPAC name is 1-carbamoyl-4-[[1-(2-methyl-N-sulfinatoanilino)cyclopentanecarbonyl]amino]adamantane.
| Compound Name | 1-carbamoyl-4-[[1-(2-methyl-N-sulfinatoanilino)cyclopentanecarbonyl]amino]adamantane |
|---|---|
| PubChem CID | 71247841 |
| Molecular Formula | C24H32N3O4S- |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 1-carbamoyl-4-[[1-(2-methyl-N-sulfinatoanilino)cyclopentanecarbonyl]amino]adamantane |
| SMILES | Cc1ccccc1N(S(=O)[O-])C1(C(=O)NC2C3CC4CC2CC(C(N)=O)(C4)C3)CCCC1 |
| InChI | InChI=1S/C24H33N3O4S/c1-15-6-2-3-7-19(15)27(32(30)31)24(8-4-5-9-24)22(29)26-20-17-10-16-11-18(20)14-23(12-16,13-17)21(25)28/h2-3,6-7,16-18,20H,4-5,8-14H2,1H3,(H2,25,28)(H,26,29)(H,30,31)/p-1 |
| InChIKey | FUSQOAJVPUQFSB-UHFFFAOYSA-M |
| XLogP | 2.70 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|